C26H35N6O8P — CID 162423587
propan-2-yl (2S)-2-[[[(1R,2R,3S,4R)-4-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 162423587) has the molecular formula C26H35N6O8P and a molecular weight of 590.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,2R,3S,4R)-4-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,2R,3S,4R)-4-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 162423587 |
| Molecular Formula | C26H35N6O8P |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,2R,3S,4R)-4-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc(N)c2c(C(N)=O)cn([C@@H]3C[C@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc4ccccc4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C26H35N6O8P/c1-13(2)39-26(36)14(3)31-41(37,40-17-8-6-5-7-9-17)38-12-16-10-19(22(34)21(16)33)32-11-18(24(28)35)20-23(27)29-15(4)30-25(20)32/h5-9,11,13-14,16,19,21-22,33-34H,10,12H2,1-4H3,(H2,28,35)(H,31,37)(H2,27,29,30)/t14-,16+,19+,21+,22-,41?/m0/s1 |
| InChIKey | SOIVUTWVVTWOHH-QWKAQOPFSA-N |
| XLogP | 1.84 |
| TPSA | 214.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|