C29H27BrN2O3 — CID 162425570
ethyl 5-bromo-3-[(4-methylphenyl)methyl]-13-oxo-12-phenyl-3,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11-tetraene-4-carboxylate (PubChem CID 162425570) has the molecular formula C29H27BrN2O3 and a molecular weight of 531.45 g/mol. Its IUPAC name is ethyl 5-bromo-3-[(4-methylphenyl)methyl]-13-oxo-12-phenyl-3,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11-tetraene-4-carboxylate.
| Compound Name | ethyl 5-bromo-3-[(4-methylphenyl)methyl]-13-oxo-12-phenyl-3,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 162425570 |
| Molecular Formula | C29H27BrN2O3 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | ethyl 5-bromo-3-[(4-methylphenyl)methyl]-13-oxo-12-phenyl-3,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11-tetraene-4-carboxylate |
| SMILES | CCOC(=O)c1c(Br)c2c(n1Cc1ccc(C)cc1)-c1[nH]c(=O)c(-c3ccccc3)cc1CCC2 |
| InChI | InChI=1S/C29H27BrN2O3/c1-3-35-29(34)27-24(30)22-11-7-10-21-16-23(20-8-5-4-6-9-20)28(33)31-25(21)26(22)32(27)17-19-14-12-18(2)13-15-19/h4-6,8-9,12-16H,3,7,10-11,17H2,1-2H3,(H,31,33) |
| InChIKey | OBDJJUKXCOPGRY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |