C16H21NO4S — CID 162425966
ethyl 2-[1-(benzylcarbamoyloxy)ethylsulfanylmethyl]prop-2-enoate (PubChem CID 162425966) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is ethyl 2-[1-(benzylcarbamoyloxy)ethylsulfanylmethyl]prop-2-enoate.
| Compound Name | ethyl 2-[1-(benzylcarbamoyloxy)ethylsulfanylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 162425966 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethyl 2-[1-(benzylcarbamoyloxy)ethylsulfanylmethyl]prop-2-enoate |
| SMILES | C=C(CSC(C)OC(=O)NCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H21NO4S/c1-4-20-15(18)12(2)11-22-13(3)21-16(19)17-10-14-8-6-5-7-9-14/h5-9,13H,2,4,10-11H2,1,3H3,(H,17,19) |
| InChIKey | GDYZIFFHIDYKAX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|