About [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate
[amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate (PubChem CID 67843075) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate.
Molecular Properties
| Compound Name | [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate |
| PubChem CID | 67843075 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate |
| SMILES | C=C(CC(=O)NCc1ccccc1)C(=O)OC(N)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c1-14(12-17(22)21-13-15-8-4-2-5-9-15)19(23)24-18(20)16-10-6-3-7-11-16/h2-11,18H,1,12-13,20H2,(H,21,22) |
| InChIKey | UHYPRHGXNLTSRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate?
The IUPAC name of [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate (CID 67843075) is [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate.
What is the SMILES notation for [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate?
The canonical SMILES for [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate is C=C(CC(=O)NCc1ccccc1)C(=O)OC(N)c1ccccc1.
What is the InChIKey of [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate?
The InChIKey is UHYPRHGXNLTSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-14(12-17(22)21-13-15-8-4-2-5-9-15)19(23)24-18(20)16-10-6-3-7-11-16/h2-11,18H,1,12-13,20H2,(H,21,22).
What are the key properties of [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate?
[amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate has a molecular weight of 324.38 g/mol, XLogP of 2.45, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(phenyl)methyl] 4-(benzylamino)-2-methylidene-4-oxobutanoate is sourced from PubChem (CID 67843075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).