C28H32BrNO12S — CID 162426095
[(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-6-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexyl] acetate (PubChem CID 162426095) has the molecular formula C28H32BrNO12S and a molecular weight of 686.53 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-6-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-6-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexyl] acetate |
|---|---|
| PubChem CID | 162426095 |
| Molecular Formula | C28H32BrNO12S |
| Molecular Weight | 686.53 g/mol |
| Exact Mass | 685.08 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-6-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](CNS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1)OC(C)=O |
| InChI | InChI=1S/C28H32BrNO12S/c1-16(31)38-15-26(40-18(3)33)28(42-20(5)35)27(41-19(4)34)25(39-17(2)32)14-30-43(36,37)24-12-8-22(9-13-24)21-6-10-23(29)11-7-21/h6-13,25-28,30H,14-15H2,1-5H3/t25-,26+,27+,28+/m0/s1 |
| InChIKey | WAOUYFHMOHJQFQ-KUXCXQDQSA-N |
| XLogP | 2.68 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|