C23H22Cl2F3N3O2 — CID 162429195
N-butyl-2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dihydroisoindole-5-carboxamide (PubChem CID 162429195) has the molecular formula C23H22Cl2F3N3O2 and a molecular weight of 500.35 g/mol. Its IUPAC name is N-butyl-2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-butyl-2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 162429195 |
| Molecular Formula | C23H22Cl2F3N3O2 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-butyl-2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dihydroisoindole-5-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)CN(C1=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C1)C2 |
| InChI | InChI=1S/C23H22Cl2F3N3O2/c1-2-3-6-29-21(32)14-4-5-15-12-31(13-16(15)7-14)20-11-22(33-30-20,23(26,27)28)17-8-18(24)10-19(25)9-17/h4-5,7-10H,2-3,6,11-13H2,1H3,(H,29,32) |
| InChIKey | PZMTVPQDJXJKNU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|