C16H18F4O4S — CID 162434655
diethyl 2-benzyl-2-(1,1,2,2-tetrafluoroethylsulfanyl)propanedioate (PubChem CID 162434655) has the molecular formula C16H18F4O4S and a molecular weight of 382.38 g/mol. Its IUPAC name is diethyl 2-benzyl-2-(1,1,2,2-tetrafluoroethylsulfanyl)propanedioate.
| Compound Name | diethyl 2-benzyl-2-(1,1,2,2-tetrafluoroethylsulfanyl)propanedioate |
|---|---|
| PubChem CID | 162434655 |
| Molecular Formula | C16H18F4O4S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | diethyl 2-benzyl-2-(1,1,2,2-tetrafluoroethylsulfanyl)propanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(SC(F)(F)C(F)F)C(=O)OCC |
| InChI | InChI=1S/C16H18F4O4S/c1-3-23-13(21)15(14(22)24-4-2,25-16(19,20)12(17)18)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | QXEGUVKIUMRQTK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|