C13H9F8NS — CID 162434660
3-(2,2,3,3,4,4,5,5-octafluoropentylsulfanyl)-1H-indole (PubChem CID 162434660) has the molecular formula C13H9F8NS and a molecular weight of 363.27 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5-octafluoropentylsulfanyl)-1H-indole.
| Compound Name | 3-(2,2,3,3,4,4,5,5-octafluoropentylsulfanyl)-1H-indole |
|---|---|
| PubChem CID | 162434660 |
| Molecular Formula | C13H9F8NS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5-octafluoropentylsulfanyl)-1H-indole |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CSc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H9F8NS/c14-10(15)12(18,19)13(20,21)11(16,17)6-23-9-5-22-8-4-2-1-3-7(8)9/h1-5,10,22H,6H2 |
| InChIKey | HYNAJIWLOSROIZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|