C22H20F3N5O — CID 162435330
[4-(azidomethyl)piperidin-1-yl]-[4-(1H-indol-4-yl)-3-(trifluoromethyl)phenyl]methanone (PubChem CID 162435330) has the molecular formula C22H20F3N5O and a molecular weight of 427.43 g/mol. Its IUPAC name is [4-(azidomethyl)piperidin-1-yl]-[4-(1H-indol-4-yl)-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(azidomethyl)piperidin-1-yl]-[4-(1H-indol-4-yl)-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 162435330 |
| Molecular Formula | C22H20F3N5O |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | [4-(azidomethyl)piperidin-1-yl]-[4-(1H-indol-4-yl)-3-(trifluoromethyl)phenyl]methanone |
| SMILES | [N-]=[N+]=NCC1CCN(C(=O)c2ccc(-c3cccc4[nH]ccc34)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H20F3N5O/c23-22(24,25)19-12-15(21(31)30-10-7-14(8-11-30)13-28-29-26)4-5-17(19)16-2-1-3-20-18(16)6-9-27-20/h1-6,9,12,14,27H,7-8,10-11,13H2 |
| InChIKey | PFYJTHDCYQMCRT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|