C17H27N5O3S — CID 162435422
N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 162435422) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 162435422 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)NCCN2CCC(CN=[N+]=[N-])CC2)cc1 |
| InChI | InChI=1S/C17H27N5O3S/c1-14(2)25-16-3-5-17(6-4-16)26(23,24)20-9-12-22-10-7-15(8-11-22)13-19-21-18/h3-6,14-15,20H,7-13H2,1-2H3 |
| InChIKey | GIDWQDJROLXFIM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|