C22H26N6O2S — CID 162435249
N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-(2-cyano-6-methylphenyl)benzenesulfonamide (PubChem CID 162435249) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-(2-cyano-6-methylphenyl)benzenesulfonamide.
| Compound Name | N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-(2-cyano-6-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162435249 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[2-[4-(azidomethyl)piperidin-1-yl]ethyl]-4-(2-cyano-6-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(C#N)c1-c1ccc(S(=O)(=O)NCCN2CCC(CN=[N+]=[N-])CC2)cc1 |
| InChI | InChI=1S/C22H26N6O2S/c1-17-3-2-4-20(15-23)22(17)19-5-7-21(8-6-19)31(29,30)26-11-14-28-12-9-18(10-13-28)16-25-27-24/h2-8,18,26H,9-14,16H2,1H3 |
| InChIKey | QYVGHEVHDBGTIW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|