C6H7ClFN — CID 162436286
(2Z,4Z)-4-chloro-5-fluoro-N-methylpenta-2,4-dien-1-imine (PubChem CID 162436286) has the molecular formula C6H7ClFN and a molecular weight of 147.58 g/mol. Its IUPAC name is (2Z,4Z)-4-chloro-5-fluoro-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-4-chloro-5-fluoro-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 162436286 |
| Molecular Formula | C6H7ClFN |
| Molecular Weight | 147.58 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | (2Z,4Z)-4-chloro-5-fluoro-N-methylpenta-2,4-dien-1-imine |
| SMILES | C/N=C/C=C\C(Cl)=C\F |
| InChI | InChI=1S/C6H7ClFN/c1-9-4-2-3-6(7)5-8/h2-5H,1H3/b3-2-,6-5-,9-4+ |
| InChIKey | KUJKGGBTTRBNHE-YGPBBABDSA-N |
| XLogP | 2.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|