C9H11ClFN — CID 91280483
7-chloro-3-fluoro-N-methylocta-2,4,6-trien-1-imine (PubChem CID 91280483) has the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. Its IUPAC name is 7-chloro-3-fluoro-N-methylocta-2,4,6-trien-1-imine.
| Compound Name | 7-chloro-3-fluoro-N-methylocta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 91280483 |
| Molecular Formula | C9H11ClFN |
| Molecular Weight | 187.64 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 7-chloro-3-fluoro-N-methylocta-2,4,6-trien-1-imine |
| SMILES | C/N=C/C=C(F)C=CC=C(C)Cl |
| InChI | InChI=1S/C9H11ClFN/c1-8(10)4-3-5-9(11)6-7-12-2/h3-7H,1-2H3/b5-3?,8-4?,9-6?,12-7+ |
| InChIKey | OAXVOQDUXKZAST-RSHRRSBCSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|