C15H25NO2 — CID 162439370
2-(hydroxymethyl)-1-[(3Z)-6-methyl-2-methylidenehepta-3,5-dienyl]piperidin-4-ol (PubChem CID 162439370) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-[(3Z)-6-methyl-2-methylidenehepta-3,5-dienyl]piperidin-4-ol.
| Compound Name | 2-(hydroxymethyl)-1-[(3Z)-6-methyl-2-methylidenehepta-3,5-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 162439370 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-(hydroxymethyl)-1-[(3Z)-6-methyl-2-methylidenehepta-3,5-dienyl]piperidin-4-ol |
| SMILES | C=C(/C=C\C=C(C)C)CN1CCC(O)CC1CO |
| InChI | InChI=1S/C15H25NO2/c1-12(2)5-4-6-13(3)10-16-8-7-15(18)9-14(16)11-17/h4-6,14-15,17-18H,3,7-11H2,1-2H3/b6-4- |
| InChIKey | KCLNXLLOWKGFLC-XQRVVYSFSA-N |
| XLogP | 1.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|