C15H22FN3O3 — CID 162439842
tert-butyl N-[5-fluoro-2-[(3R)-3-methylmorpholin-4-yl]-4-pyridinyl]carbamate (PubChem CID 162439842) has the molecular formula C15H22FN3O3 and a molecular weight of 311.36 g/mol. Its IUPAC name is tert-butyl N-[5-fluoro-2-[(3R)-3-methylmorpholin-4-yl]-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-fluoro-2-[(3R)-3-methylmorpholin-4-yl]-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 162439842 |
| Molecular Formula | C15H22FN3O3 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | tert-butyl N-[5-fluoro-2-[(3R)-3-methylmorpholin-4-yl]-4-pyridinyl]carbamate |
| SMILES | C[C@@H]1COCCN1c1cc(NC(=O)OC(C)(C)C)c(F)cn1 |
| InChI | InChI=1S/C15H22FN3O3/c1-10-9-21-6-5-19(10)13-7-12(11(16)8-17-13)18-14(20)22-15(2,3)4/h7-8,10H,5-6,9H2,1-4H3,(H,17,18,20)/t10-/m1/s1 |
| InChIKey | LTPMBXFTDSHZGY-SNVBAGLBSA-N |
| XLogP | 2.79 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |