C9H17N3 — CID 162443452
(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine (PubChem CID 162443452) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 162443452 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine |
| SMILES | C=C/C=C(\N)N1CCN(C)CC1 |
| InChI | InChI=1S/C9H17N3/c1-3-4-9(10)12-7-5-11(2)6-8-12/h3-4H,1,5-8,10H2,2H3/b9-4+ |
| InChIKey | GWMNPJGJXJPGJI-RUDMXATFSA-N |
| XLogP | 0.22 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|