C41H75NO — CID 162444085
1-amino-11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-4-methylideneundecan-1-ol (PubChem CID 162444085) has the molecular formula C41H75NO and a molecular weight of 598.06 g/mol. Its IUPAC name is 1-amino-11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-4-methylideneundecan-1-ol.
| Compound Name | 1-amino-11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-4-methylideneundecan-1-ol |
|---|---|
| PubChem CID | 162444085 |
| Molecular Formula | C41H75NO |
| Molecular Weight | 598.06 g/mol |
| Exact Mass | 597.58 |
| IUPAC Name | 1-amino-11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-4-methylideneundecan-1-ol |
| SMILES | C=CCCCCCCCC1CC(CCCCCC)C(C/C=C/CCCCC)=CC1CCCCCCCC(=C)CCC(N)O |
| InChI | InChI=1S/C41H75NO/c1-5-8-11-14-16-20-25-30-39-34-37(28-23-13-10-7-3)38(29-24-19-15-12-9-6-2)35-40(39)31-26-21-17-18-22-27-36(4)32-33-41(42)43/h5,19,24,35,37,39-41,43H,1,4,6-18,20-23,25-34,42H2,2-3H3/b24-19+ |
| InChIKey | HEIMRRKTLJXQMT-LYBHJNIJSA-N |
| XLogP | 12.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.06 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|