C15H19NS2 — CID 162444219
4-methyl-3-phenyl-7-propylsulfanyl-4,5-dihydrothiazepine (PubChem CID 162444219) has the molecular formula C15H19NS2 and a molecular weight of 277.46 g/mol. Its IUPAC name is 4-methyl-3-phenyl-7-propylsulfanyl-4,5-dihydrothiazepine.
| Compound Name | 4-methyl-3-phenyl-7-propylsulfanyl-4,5-dihydrothiazepine |
|---|---|
| PubChem CID | 162444219 |
| Molecular Formula | C15H19NS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-methyl-3-phenyl-7-propylsulfanyl-4,5-dihydrothiazepine |
| SMILES | CCCSC1=CCC(C)C(c2ccccc2)=NS1 |
| InChI | InChI=1S/C15H19NS2/c1-3-11-17-14-10-9-12(2)15(16-18-14)13-7-5-4-6-8-13/h4-8,10,12H,3,9,11H2,1-2H3 |
| InChIKey | UYONVEMVSVOAJB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|