C16H23N — CID 170790101
2,3-dimethyl-6-phenyl-3,4-dihydropyridine;propane (PubChem CID 170790101) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 2,3-dimethyl-6-phenyl-3,4-dihydropyridine;propane.
| Compound Name | 2,3-dimethyl-6-phenyl-3,4-dihydropyridine;propane |
|---|---|
| PubChem CID | 170790101 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2,3-dimethyl-6-phenyl-3,4-dihydropyridine;propane |
| SMILES | CC1=NC(c2ccccc2)=CCC1C.CCC |
| InChI | InChI=1S/C13H15N.C3H8/c1-10-8-9-13(14-11(10)2)12-6-4-3-5-7-12;1-3-2/h3-7,9-10H,8H2,1-2H3;3H2,1-2H3 |
| InChIKey | QYRPNHWBJUFATE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |