C19H17F4N3O3 — CID 162445134
3-fluoro-N-(5-methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-4-(4,4,4-trifluorobutoxy)benzamide (PubChem CID 162445134) has the molecular formula C19H17F4N3O3 and a molecular weight of 411.36 g/mol. Its IUPAC name is 3-fluoro-N-(5-methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-4-(4,4,4-trifluorobutoxy)benzamide.
| Compound Name | 3-fluoro-N-(5-methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-4-(4,4,4-trifluorobutoxy)benzamide |
|---|---|
| PubChem CID | 162445134 |
| Molecular Formula | C19H17F4N3O3 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-fluoro-N-(5-methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-4-(4,4,4-trifluorobutoxy)benzamide |
| SMILES | COc1ccc2[nH]cc(NC(=O)c3ccc(OCCCC(F)(F)F)c(F)c3)c2n1 |
| InChI | InChI=1S/C19H17F4N3O3/c1-28-16-6-4-13-17(26-16)14(10-24-13)25-18(27)11-3-5-15(12(20)9-11)29-8-2-7-19(21,22)23/h3-6,9-10,24H,2,7-8H2,1H3,(H,25,27) |
| InChIKey | ZZISGXRDEPFUOH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|