C11H11N3O2 — CID 162446305
N-(7-oxidopyrrolo[2,3-b]pyridin-7-ium-1-yl)cyclopropanecarboxamide (PubChem CID 162446305) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-(7-oxidopyrrolo[2,3-b]pyridin-7-ium-1-yl)cyclopropanecarboxamide.
| Compound Name | N-(7-oxidopyrrolo[2,3-b]pyridin-7-ium-1-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 162446305 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-(7-oxidopyrrolo[2,3-b]pyridin-7-ium-1-yl)cyclopropanecarboxamide |
| SMILES | O=C(Nn1ccc2ccc[n+]([O-])c21)C1CC1 |
| InChI | InChI=1S/C11H11N3O2/c15-10(8-3-4-8)12-13-7-5-9-2-1-6-14(16)11(9)13/h1-2,5-8H,3-4H2,(H,12,15) |
| InChIKey | ZNDQKXNUPXJAKN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 60.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|