C20H20N8O2 — CID 171722340
1-N,4-N-bis(benzotriazol-2-yl)cyclohexane-1,4-dicarboxamide (PubChem CID 171722340) has the molecular formula C20H20N8O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-N,4-N-bis(benzotriazol-2-yl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(benzotriazol-2-yl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171722340 |
| Molecular Formula | C20H20N8O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-N,4-N-bis(benzotriazol-2-yl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(Nn1nc2ccccc2n1)C1CCC(C(=O)Nn2nc3ccccc3n2)CC1 |
| InChI | InChI=1S/C20H20N8O2/c29-19(25-27-21-15-5-1-2-6-16(15)22-27)13-9-11-14(12-10-13)20(30)26-28-23-17-7-3-4-8-18(17)24-28/h1-8,13-14H,9-12H2,(H,25,29)(H,26,30) |
| InChIKey | PAEQCZQDVOORMH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |