C22H27Cl2NO6S — CID 162453365
(3R)-4-[4-[2-[3,5-dichloro-4-[[(2R)-oxiran-2-yl]methoxy]phenyl]propan-2-yl]phenoxy]-3-hydroxybutane-1-sulfonamide (PubChem CID 162453365) has the molecular formula C22H27Cl2NO6S and a molecular weight of 504.43 g/mol. Its IUPAC name is (3R)-4-[4-[2-[3,5-dichloro-4-[[(2R)-oxiran-2-yl]methoxy]phenyl]propan-2-yl]phenoxy]-3-hydroxybutane-1-sulfonamide.
| Compound Name | (3R)-4-[4-[2-[3,5-dichloro-4-[[(2R)-oxiran-2-yl]methoxy]phenyl]propan-2-yl]phenoxy]-3-hydroxybutane-1-sulfonamide |
|---|---|
| PubChem CID | 162453365 |
| Molecular Formula | C22H27Cl2NO6S |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (3R)-4-[4-[2-[3,5-dichloro-4-[[(2R)-oxiran-2-yl]methoxy]phenyl]propan-2-yl]phenoxy]-3-hydroxybutane-1-sulfonamide |
| SMILES | CC(C)(c1ccc(OC[C@H](O)CCS(N)(=O)=O)cc1)c1cc(Cl)c(OC[C@H]2CO2)c(Cl)c1 |
| InChI | InChI=1S/C22H27Cl2NO6S/c1-22(2,15-9-19(23)21(20(24)10-15)31-13-18-12-30-18)14-3-5-17(6-4-14)29-11-16(26)7-8-32(25,27)28/h3-6,9-10,16,18,26H,7-8,11-13H2,1-2H3,(H2,25,27,28)/t16-,18-/m1/s1 |
| InChIKey | BQXQBVHUTWWYMG-SJLPKXTDSA-N |
| XLogP | 3.52 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|