C7H11NaO2S — CID 162455609
sodium cis-(1S,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane (PubChem CID 162455609) has the molecular formula C7H11NaO2S and a molecular weight of 182.22 g/mol. Its IUPAC name is sodium cis-(1S,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane.
| Compound Name | sodium cis-(1S,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane |
|---|---|
| PubChem CID | 162455609 |
| Molecular Formula | C7H11NaO2S |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | sodium cis-(1S,2S)-1-[(E)-prop-1-enyl]-2-(sulfinatomethyl)cyclopropane |
| SMILES | C/C=C/[C@@H]1C[C@@H]1C[S-](=O)=O.[Na+] |
| InChI | InChI=1S/C7H11O2S.Na/c1-2-3-6-4-7(6)5-10(8)9;/h2-3,6-7H,4-5H2,1H3;/q-1;+1/b3-2+;/t6-,7-;/m1./s1 |
| InChIKey | NJLPYMNPFPKVMP-YUBDSWSDSA-N |
| XLogP | -1.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|