C19H15Cl2F2N5O7S — CID 162457628
2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclobutyl]pyridine-4-sulfonamide (PubChem CID 162457628) has the molecular formula C19H15Cl2F2N5O7S and a molecular weight of 566.33 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclobutyl]pyridine-4-sulfonamide.
| Compound Name | 2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclobutyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 162457628 |
| Molecular Formula | C19H15Cl2F2N5O7S |
| Molecular Weight | 566.33 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | 2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclobutyl]pyridine-4-sulfonamide |
| SMILES | O=c1[nH]c(=O)n(-c2cc(Cl)c(Oc3cc(S(=O)(=O)N[C@@H]4CC[C@H]4O)c(O)cn3)c(Cl)c2)nc1C(F)F |
| InChI | InChI=1S/C19H15Cl2F2N5O7S/c20-8-3-7(28-19(32)25-18(31)15(26-28)17(22)23)4-9(21)16(8)35-14-5-13(12(30)6-24-14)36(33,34)27-10-1-2-11(10)29/h3-6,10-11,17,27,29-30H,1-2H2,(H,25,31,32)/t10-,11-/m1/s1 |
| InChIKey | MNCYWHZTTLCHLG-GHMZBOCLSA-N |
| XLogP | 1.86 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |