C22H17Cl2F4N5O7S — CID 158644205
1-[[5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxyphenyl]sulfonylamino]-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide (PubChem CID 158644205) has the molecular formula C22H17Cl2F4N5O7S and a molecular weight of 642.37 g/mol. Its IUPAC name is 1-[[5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxyphenyl]sulfonylamino]-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[[5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxyphenyl]sulfonylamino]-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 158644205 |
| Molecular Formula | C22H17Cl2F4N5O7S |
| Molecular Weight | 642.37 g/mol |
| Exact Mass | 641.02 |
| IUPAC Name | 1-[[5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxyphenyl]sulfonylamino]-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCC(F)F)C1(NS(=O)(=O)c2cc(Oc3c(Cl)cc(-n4nc(C(F)F)c(=O)[nH]c4=O)cc3Cl)ccc2O)CC1 |
| InChI | InChI=1S/C22H17Cl2F4N5O7S/c23-11-5-9(33-21(37)30-19(35)16(31-33)18(27)28)6-12(24)17(11)40-10-1-2-13(34)14(7-10)41(38,39)32-22(3-4-22)20(36)29-8-15(25)26/h1-2,5-7,15,18,32,34H,3-4,8H2,(H,29,36)(H,30,35,37) |
| InChIKey | IATLVZCWPXPQCS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 172.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |