C21H20Cl2F2N4O6S — CID 175809194
5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxy-3-pentylbenzenesulfonamide (PubChem CID 175809194) has the molecular formula C21H20Cl2F2N4O6S and a molecular weight of 565.38 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxy-3-pentylbenzenesulfonamide.
| Compound Name | 5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxy-3-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 175809194 |
| Molecular Formula | C21H20Cl2F2N4O6S |
| Molecular Weight | 565.38 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | 5-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-2-hydroxy-3-pentylbenzenesulfonamide |
| SMILES | CCCCCc1cc(Oc2c(Cl)cc(-n3nc(C(F)F)c(=O)[nH]c3=O)cc2Cl)cc(S(N)(=O)=O)c1O |
| InChI | InChI=1S/C21H20Cl2F2N4O6S/c1-2-3-4-5-10-6-12(9-15(17(10)30)36(26,33)34)35-18-13(22)7-11(8-14(18)23)29-21(32)27-20(31)16(28-29)19(24)25/h6-9,19,30H,2-5H2,1H3,(H2,26,33,34)(H,27,31,32) |
| InChIKey | JZZPFSSNRPTTNI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|