C41H26CuN2O2P+ — CID 162457869
copper diphenyl-[2-(10-pyridin-2-yl-11H-benzo[b]phenoxazin-11-id-12-yl)-3H-1-benzofuran-3-id-4-yl]phosphanium (PubChem CID 162457869) has the molecular formula C41H26CuN2O2P+ and a molecular weight of 673.19 g/mol. Its IUPAC name is copper diphenyl-[2-(10-pyridin-2-yl-11H-benzo[b]phenoxazin-11-id-12-yl)-3H-1-benzofuran-3-id-4-yl]phosphanium.
| Compound Name | copper diphenyl-[2-(10-pyridin-2-yl-11H-benzo[b]phenoxazin-11-id-12-yl)-3H-1-benzofuran-3-id-4-yl]phosphanium |
|---|---|
| PubChem CID | 162457869 |
| Molecular Formula | C41H26CuN2O2P+ |
| Molecular Weight | 673.19 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | copper diphenyl-[2-(10-pyridin-2-yl-11H-benzo[b]phenoxazin-11-id-12-yl)-3H-1-benzofuran-3-id-4-yl]phosphanium |
| SMILES | [Cu+2].[c-]1c2c(cc3cccc(-c4ccccn4)c13)Oc1ccccc1N2c1[c-]c2c([PH+](c3ccccc3)c3ccccc3)cccc2o1 |
| InChI | InChI=1S/C41H25N2O2P.Cu/c1-3-14-29(15-4-1)46(30-16-5-2-6-17-30)40-23-12-22-37-33(40)27-41(45-37)43-35-20-7-8-21-38(35)44-39-25-28-13-11-18-31(32(28)26-36(39)43)34-19-9-10-24-42-34;/h1-25H;/q-2;+2/p+1 |
| InChIKey | XQOBCVGVJSJUAJ-UHFFFAOYSA-O |
| XLogP | 9.31 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.19 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|