About CID 140691250
CID 140691250 (PubChem CID 140691250) has the molecular formula C39H25IrN4O2Si
and a molecular weight of 801.96 g/mol.
Molecular Properties
| Compound Name | CID 140691250 |
| PubChem CID | 140691250 |
| Molecular Formula | C39H25IrN4O2Si |
| Molecular Weight | 801.96 g/mol |
| Exact Mass | 802.14 |
| IUPAC Name | — |
| SMILES | [Ir].c1ccc([Si](c2ccccc2)c2cccc3oc(N4c5ccccc5Oc5cc6cccc(-c7ccccn7)c6nc54)nc23)cc1 |
| InChI | InChI=1S/C39H25N4O2Si.Ir/c1-3-14-27(15-4-1)46(28-16-5-2-6-17-28)35-23-12-22-33-37(35)42-39(45-33)43-31-20-7-8-21-32(31)44-34-25-26-13-11-18-29(36(26)41-38(34)43)30-19-9-10-24-40-30;/h1-25H; |
| InChIKey | DCYBXETZHIRRJP-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 801.96 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 140691250 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140691250?
The IUPAC name of CID 140691250 (CID 140691250) is not available.
What is the SMILES notation for CID 140691250?
The canonical SMILES for CID 140691250 is [Ir].c1ccc([Si](c2ccccc2)c2cccc3oc(N4c5ccccc5Oc5cc6cccc(-c7ccccn7)c6nc54)nc23)cc1.
What is the InChIKey of CID 140691250?
The InChIKey is DCYBXETZHIRRJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H25N4O2Si.Ir/c1-3-14-27(15-4-1)46(28-16-5-2-6-17-28)35-23-12-22-33-37(35)42-39(45-33)43-31-20-7-8-21-32(31)44-34-25-26-13-11-18-29(36(26)41-38(34)43)30-19-9-10-24-40-30;/h1-25H;.
What are the key properties of CID 140691250?
CID 140691250 has a molecular weight of 801.96 g/mol, XLogP of 7.53, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140691250 is sourced from PubChem (CID 140691250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).