C28H50ClN7O6 — CID 162458616
N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-morpholin-4-yl-6-(oxetan-3-ylamino)-1,3-diazinane-4-carboxamide (PubChem CID 162458616) has the molecular formula C28H50ClN7O6 and a molecular weight of 616.20 g/mol. Its IUPAC name is N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-morpholin-4-yl-6-(oxetan-3-ylamino)-1,3-diazinane-4-carboxamide.
| Compound Name | N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-morpholin-4-yl-6-(oxetan-3-ylamino)-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 162458616 |
| Molecular Formula | C28H50ClN7O6 |
| Molecular Weight | 616.20 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | N-[(2S)-3-[5-chloro-6-(1,3-oxazolidin-5-ylmethoxy)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypropyl]-2-morpholin-4-yl-6-(oxetan-3-ylamino)-1,3-diazinane-4-carboxamide |
| SMILES | O=C(NC[C@H](O)CN1CCC2C(CCC(OCC3CNCO3)C2Cl)C1)C1CC(NC2COC2)NC(N2CCOCC2)N1 |
| InChI | InChI=1S/C28H50ClN7O6/c29-26-22-3-4-35(12-18(22)1-2-24(26)41-16-21-11-30-17-42-21)13-20(37)10-31-27(38)23-9-25(32-19-14-40-15-19)34-28(33-23)36-5-7-39-8-6-36/h18-26,28,30,32-34,37H,1-17H2,(H,31,38)/t18?,20-,21?,22?,23?,24?,25?,26?,28?/m0/s1 |
| InChIKey | BYWHYRZZZLTAAW-XIEHXSIWSA-N |
| XLogP | -1.98 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.20 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|