C56H42N4O — CID 162460796
2-N-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N-[3-[9-(5,5-dimethylindeno[1,2-c]pyridin-3-yl)carbazol-2-yl]oxyphenyl]benzene-1,2-diamine (PubChem CID 162460796) has the molecular formula C56H42N4O and a molecular weight of 797.04 g/mol. Its IUPAC name is 2-N-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N-[3-[9-(5,5-dimethylindeno[1,2-c]pyridin-3-yl)carbazol-2-yl]oxyphenyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N-[3-[9-(5,5-dimethylindeno[1,2-c]pyridin-3-yl)carbazol-2-yl]oxyphenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 162460796 |
| Molecular Formula | C56H42N4O |
| Molecular Weight | 797.04 g/mol |
| Exact Mass | 796.40 |
| IUPAC Name | 2-N-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N-[3-[9-(5,5-dimethylindeno[1,2-c]pyridin-3-yl)carbazol-2-yl]oxyphenyl]benzene-1,2-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2Nc2ccccc2Nc2cccc(Oc3ccc4c5ccccc5n(-c5cc6c(cn5)-c5ccccc5C6(C)C)c4c3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C56H42N4O/c1-56(2)48-27-11-9-23-44(48)47-36-57-54(35-49(47)56)60-52-30-14-10-24-45(52)46-32-31-41(34-53(46)60)61-40-22-15-21-39(33-40)58-50-28-12-13-29-51(50)59-55-42(37-17-5-3-6-18-37)25-16-26-43(55)38-19-7-4-8-20-38/h3-36,58-59H,1-2H3/i3D,4D,5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | UDTXQIOVFNINAI-AVMQJJGISA-N |
| XLogP | 15.10 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.04 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |