C63H42N4O — CID 168782328
CID 168782328 (PubChem CID 168782328) has the molecular formula C63H42N4O and a molecular weight of 884.14 g/mol.
| Compound Name | CID 168782328 |
|---|---|
| PubChem CID | 168782328 |
| Molecular Formula | C63H42N4O |
| Molecular Weight | 884.14 g/mol |
| Exact Mass | 883.42 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2-[n+]2[c-]n(-c4cccc(Oc5ccc6c7ccccc7n(-c7cc8c(cn7)-c7ccccc7C8(C)C)c6c5)c4)c4cccc(c42)-c2c([2H])c([2H])c([2H])c([2H])c2-c2c([2H])c([2H])c([2H])c([2H])c2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C63H42N4O/c1-63(2)55-30-12-10-25-49(55)54-38-64-60(37-56(54)63)67-57-31-13-11-26-50(57)51-34-33-43(36-59(51)67)68-42-20-14-19-41(35-42)65-39-66-61-44(40-17-4-3-5-18-40)27-15-28-52(61)47-23-8-6-21-45(47)46-22-7-9-24-48(46)53-29-16-32-58(65)62(53)66/h3-38H,1-2H3/i3D,4D,5D,6D,7D,8D,9D,17D,18D,21D,22D,23D,24D |
| InChIKey | OHUBPZJMKFZGFW-VJZZRUFGSA-N |
| XLogP | 15.28 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.14 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|