C55H41N3O — CID 171474756
2-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-[3-[9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]oxyphenyl]aniline (PubChem CID 171474756) has the molecular formula C55H41N3O and a molecular weight of 776.05 g/mol. Its IUPAC name is 2-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-[3-[9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]oxyphenyl]aniline.
| Compound Name | 2-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-[3-[9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]oxyphenyl]aniline |
|---|---|
| PubChem CID | 171474756 |
| Molecular Formula | C55H41N3O |
| Molecular Weight | 776.05 g/mol |
| Exact Mass | 775.43 |
| IUPAC Name | 2-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-[3-[9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]oxyphenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-c2ccccc2Nc2cccc(Oc3ccc4c5ccccc5n(-c5ncc(C([2H])([2H])[2H])c(-c6ccccc6)c5C([2H])([2H])[2H])c4c3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C55H41N3O/c1-37-36-56-55(38(2)53(37)41-22-10-5-11-23-41)58-51-31-15-13-26-47(51)48-33-32-44(35-52(48)58)59-43-25-16-24-42(34-43)57-50-30-14-12-27-49(50)54-45(39-18-6-3-7-19-39)28-17-29-46(54)40-20-8-4-9-21-40/h3-36,57H,1-2H3/i1D3,2D3,3D,4D,6D,7D,8D,9D,18D,19D,20D,21D |
| InChIKey | CGYYLHYRSCKOPN-HNLRQOKXSA-N |
| XLogP | 15.00 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.05 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |