C31H22N4ORh — CID 162463251
4-dibenzofuran-3-yl-3-methyl-1-phenylpyrazole;1-phenylpyrazole;rhodium(2+) (PubChem CID 162463251) has the molecular formula C31H22N4ORh and a molecular weight of 569.45 g/mol. Its IUPAC name is 4-dibenzofuran-3-yl-3-methyl-1-phenylpyrazole;1-phenylpyrazole;rhodium(2+).
| Compound Name | 4-dibenzofuran-3-yl-3-methyl-1-phenylpyrazole;1-phenylpyrazole;rhodium(2+) |
|---|---|
| PubChem CID | 162463251 |
| Molecular Formula | C31H22N4ORh |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | 4-dibenzofuran-3-yl-3-methyl-1-phenylpyrazole;1-phenylpyrazole;rhodium(2+) |
| SMILES | Cc1nn(-c2[c-]cccc2)cc1-c1ccc2c(c1)oc1ccccc12.[Rh+2].[c-]1ccccc1-n1cccn1 |
| InChI | InChI=1S/C22H15N2O.C9H7N2.Rh/c1-15-20(14-24(23-15)17-7-3-2-4-8-17)16-11-12-19-18-9-5-6-10-21(18)25-22(19)13-16;1-2-5-9(6-3-1)11-8-4-7-10-11;/h2-7,9-14H,1H3;1-5,7-8H;/q2*-1;+2 |
| InChIKey | DMMPGIONYXVUDZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|