C30H55NO16P2S — CID 162464066
[4-[3-[2-[2-[4-(5-ethoxy-5-oxopentoxy)carbonylhept-6-enoxycarbonyl]-5-hydroxypentoxy]ethylsulfanyl]propanoylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 162464066) has the molecular formula C30H55NO16P2S and a molecular weight of 779.78 g/mol. Its IUPAC name is [4-[3-[2-[2-[4-(5-ethoxy-5-oxopentoxy)carbonylhept-6-enoxycarbonyl]-5-hydroxypentoxy]ethylsulfanyl]propanoylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[3-[2-[2-[4-(5-ethoxy-5-oxopentoxy)carbonylhept-6-enoxycarbonyl]-5-hydroxypentoxy]ethylsulfanyl]propanoylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 162464066 |
| Molecular Formula | C30H55NO16P2S |
| Molecular Weight | 779.78 g/mol |
| Exact Mass | 779.27 |
| IUPAC Name | [4-[3-[2-[2-[4-(5-ethoxy-5-oxopentoxy)carbonylhept-6-enoxycarbonyl]-5-hydroxypentoxy]ethylsulfanyl]propanoylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | C=CCC(CCCOC(=O)C(CCCO)COCCSCCC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)C(=O)OCCCCC(=O)OCC |
| InChI | InChI=1S/C30H55NO16P2S/c1-3-10-24(28(35)46-18-6-5-13-27(34)45-4-2)12-8-19-47-29(36)25(11-7-17-32)23-44-20-22-50-21-14-26(33)31-16-9-15-30(37,48(38,39)40)49(41,42)43/h3,24-25,32,37H,1,4-23H2,2H3,(H,31,33)(H2,38,39,40)(H2,41,42,43) |
| InChIKey | QWVKHBDYCYAXIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 272.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|