C36H56O11S — CID 162197596
[5-(5-ethoxy-5-oxopentoxy)-4-(oxiran-2-ylmethyl)-5-oxopentyl] 5-hydroxy-2-[2-[6-(3-hydroxy-4-methylphenyl)-3-oxohexyl]sulfanylethoxymethyl]pentanoate (PubChem CID 162197596) has the molecular formula C36H56O11S and a molecular weight of 696.90 g/mol. Its IUPAC name is [5-(5-ethoxy-5-oxopentoxy)-4-(oxiran-2-ylmethyl)-5-oxopentyl] 5-hydroxy-2-[2-[6-(3-hydroxy-4-methylphenyl)-3-oxohexyl]sulfanylethoxymethyl]pentanoate.
| Compound Name | [5-(5-ethoxy-5-oxopentoxy)-4-(oxiran-2-ylmethyl)-5-oxopentyl] 5-hydroxy-2-[2-[6-(3-hydroxy-4-methylphenyl)-3-oxohexyl]sulfanylethoxymethyl]pentanoate |
|---|---|
| PubChem CID | 162197596 |
| Molecular Formula | C36H56O11S |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | [5-(5-ethoxy-5-oxopentoxy)-4-(oxiran-2-ylmethyl)-5-oxopentyl] 5-hydroxy-2-[2-[6-(3-hydroxy-4-methylphenyl)-3-oxohexyl]sulfanylethoxymethyl]pentanoate |
| SMILES | CCOC(=O)CCCCOC(=O)C(CCCOC(=O)C(CCCO)COCCSCCC(=O)CCCc1ccc(C)c(O)c1)CC1CO1 |
| InChI | InChI=1S/C36H56O11S/c1-3-44-34(40)13-4-5-18-45-35(41)29(24-32-26-47-32)11-8-19-46-36(42)30(10-7-17-37)25-43-20-22-48-21-16-31(38)12-6-9-28-15-14-27(2)33(39)23-28/h14-15,23,29-30,32,37,39H,3-13,16-22,24-26H2,1-2H3 |
| InChIKey | OWZWSWUXYNZAHH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|