C21H17F3N2O — CID 162464522
1-quinolin-8-yl-4-[2-[3-(trifluoromethyl)phenyl]ethyl]azetidin-2-one (PubChem CID 162464522) has the molecular formula C21H17F3N2O and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-quinolin-8-yl-4-[2-[3-(trifluoromethyl)phenyl]ethyl]azetidin-2-one.
| Compound Name | 1-quinolin-8-yl-4-[2-[3-(trifluoromethyl)phenyl]ethyl]azetidin-2-one |
|---|---|
| PubChem CID | 162464522 |
| Molecular Formula | C21H17F3N2O |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-quinolin-8-yl-4-[2-[3-(trifluoromethyl)phenyl]ethyl]azetidin-2-one |
| SMILES | O=C1CC(CCc2cccc(C(F)(F)F)c2)N1c1cccc2cccnc12 |
| InChI | InChI=1S/C21H17F3N2O/c22-21(23,24)16-7-1-4-14(12-16)9-10-17-13-19(27)26(17)18-8-2-5-15-6-3-11-25-20(15)18/h1-8,11-12,17H,9-10,13H2 |
| InChIKey | XATICZJJRIEFEO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |