C17H20N2O — CID 73426869
(3R,4S)-4-ethyl-3-propyl-1-quinolin-8-ylazetidin-2-one (PubChem CID 73426869) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (3R,4S)-4-ethyl-3-propyl-1-quinolin-8-ylazetidin-2-one.
| Compound Name | (3R,4S)-4-ethyl-3-propyl-1-quinolin-8-ylazetidin-2-one |
|---|---|
| PubChem CID | 73426869 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3R,4S)-4-ethyl-3-propyl-1-quinolin-8-ylazetidin-2-one |
| SMILES | CCC[C@H]1C(=O)N(c2cccc3cccnc23)[C@H]1CC |
| InChI | InChI=1S/C17H20N2O/c1-3-7-13-14(4-2)19(17(13)20)15-10-5-8-12-9-6-11-18-16(12)15/h5-6,8-11,13-14H,3-4,7H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | FHTOTTVNJJSZBK-KGLIPLIRSA-N |
| XLogP | 3.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |