C12H12F3NOS — CID 91621051
5-[2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-oxazolidine-2-thione (PubChem CID 91621051) has the molecular formula C12H12F3NOS and a molecular weight of 275.30 g/mol. Its IUPAC name is 5-[2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-oxazolidine-2-thione.
| Compound Name | 5-[2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 91621051 |
| Molecular Formula | C12H12F3NOS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-[2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-oxazolidine-2-thione |
| SMILES | FC(F)(F)c1cccc(CCC2CNC(=S)O2)c1 |
| InChI | InChI=1S/C12H12F3NOS/c13-12(14,15)9-3-1-2-8(6-9)4-5-10-7-16-11(18)17-10/h1-3,6,10H,4-5,7H2,(H,16,18) |
| InChIKey | KHTYRLISKRBHNH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|