C45H45N4OSi — CID 162465256
CID 162465256 (PubChem CID 162465256) has the molecular formula C45H45N4OSi and a molecular weight of 685.97 g/mol.
| Compound Name | CID 162465256 |
|---|---|
| PubChem CID | 162465256 |
| Molecular Formula | C45H45N4OSi |
| Molecular Weight | 685.97 g/mol |
| Exact Mass | 685.34 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccnc(-n2c3ccccc3c3ccc([Si](C)c4cccc(N5ON(C(C)C)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C45H45N4OSi/c1-29(2)36-17-13-18-37(30(3)4)45(36)32-24-25-46-44(26-32)47-40-19-9-8-16-38(40)39-23-22-35(28-43(39)47)51(7)34-15-12-14-33(27-34)49-42-21-11-10-20-41(42)48(50-49)31(5)6/h8-31H,1-7H3 |
| InChIKey | STNJXDRCYLDCCL-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.97 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|