C46H40N5OPtS- — CID 162465901
2,4-ditert-butyl-6-[4-[6-[naphthalen-1-yl(pyridin-2-yl)amino]pyrazin-2-yl]-2-phenyl-5H-1,3-benzothiazol-5-id-6-yl]phenol;platinum (PubChem CID 162465901) has the molecular formula C46H40N5OPtS- and a molecular weight of 906.01 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[6-[naphthalen-1-yl(pyridin-2-yl)amino]pyrazin-2-yl]-2-phenyl-5H-1,3-benzothiazol-5-id-6-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-[6-[naphthalen-1-yl(pyridin-2-yl)amino]pyrazin-2-yl]-2-phenyl-5H-1,3-benzothiazol-5-id-6-yl]phenol;platinum |
|---|---|
| PubChem CID | 162465901 |
| Molecular Formula | C46H40N5OPtS- |
| Molecular Weight | 906.01 g/mol |
| Exact Mass | 905.26 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[6-[naphthalen-1-yl(pyridin-2-yl)amino]pyrazin-2-yl]-2-phenyl-5H-1,3-benzothiazol-5-id-6-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2[c-]c(-c3cncc(N(c4ccccn4)c4cccc5ccccc45)n3)c3nc(-c4ccccc4)sc3c2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C46H40N5OS.Pt/c1-45(2,3)32-25-34(43(52)36(26-32)46(4,5)6)31-23-35(42-39(24-31)53-44(50-42)30-16-8-7-9-17-30)37-27-47-28-41(49-37)51(40-21-12-13-22-48-40)38-20-14-18-29-15-10-11-19-33(29)38;/h7-22,24-28,52H,1-6H3;/q-1; |
| InChIKey | QTFWKFONGBDHAM-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.01 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|