C31H27ClF3N5O4S — CID 162466225
[2-chloro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate (PubChem CID 162466225) has the molecular formula C31H27ClF3N5O4S and a molecular weight of 658.10 g/mol. Its IUPAC name is [2-chloro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate.
| Compound Name | [2-chloro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate |
|---|---|
| PubChem CID | 162466225 |
| Molecular Formula | C31H27ClF3N5O4S |
| Molecular Weight | 658.10 g/mol |
| Exact Mass | 657.14 |
| IUPAC Name | [2-chloro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)OCC(Cl)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C31H27ClF3N5O4S/c1-18(2)24-13-4-19(3)14-26(24)40-27(41)16-45-29(40)37-30(42)43-15-25(32)20-5-7-21(8-6-20)28-36-17-39(38-28)22-9-11-23(12-10-22)44-31(33,34)35/h4-14,17-18,25H,15-16H2,1-3H3/b37-29- |
| InChIKey | OLVAYKUYLUZJLL-GPFIVKHLSA-N |
| XLogP | 7.82 |
| TPSA | 98.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.10 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|