C10H13N7O5S — CID 162466656
7-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxopyrazolo[4,5-d]triazine-5-carbothioamide (PubChem CID 162466656) has the molecular formula C10H13N7O5S and a molecular weight of 343.33 g/mol. Its IUPAC name is 7-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxopyrazolo[4,5-d]triazine-5-carbothioamide.
| Compound Name | 7-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxopyrazolo[4,5-d]triazine-5-carbothioamide |
|---|---|
| PubChem CID | 162466656 |
| Molecular Formula | C10H13N7O5S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 7-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxopyrazolo[4,5-d]triazine-5-carbothioamide |
| SMILES | NC(=S)n1nc(N)c2nnn(C3OC(CO)C(O)C3O)c(=O)c21 |
| InChI | InChI=1S/C10H13N7O5S/c11-7-3-4(16(14-7)10(12)23)8(21)17(15-13-3)9-6(20)5(19)2(1-18)22-9/h2,5-6,9,18-20H,1H2,(H2,11,14)(H2,12,23) |
| InChIKey | RQIURHKVBQFKBM-UHFFFAOYSA-N |
| XLogP | -3.73 |
| TPSA | 187.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|