C8H11ClN4O4S — CID 23271394
5-chloro-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazole-4-carbothioamide (PubChem CID 23271394) has the molecular formula C8H11ClN4O4S and a molecular weight of 294.72 g/mol. Its IUPAC name is 5-chloro-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazole-4-carbothioamide.
| Compound Name | 5-chloro-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazole-4-carbothioamide |
|---|---|
| PubChem CID | 23271394 |
| Molecular Formula | C8H11ClN4O4S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 5-chloro-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazole-4-carbothioamide |
| SMILES | NC(=S)c1c(Cl)nnn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H11ClN4O4S/c9-6-3(7(10)18)13(12-11-6)8-5(16)4(15)2(1-14)17-8/h2,4-5,8,14-16H,1H2,(H2,10,18)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | XEHSPJRSCBKPSQ-UMMCILCDSA-N |
| XLogP | -1.82 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|