C8H13N5O5 — CID 46875910
5-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 46875910) has the molecular formula C8H13N5O5 and a molecular weight of 259.22 g/mol. Its IUPAC name is 5-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 46875910 |
| Molecular Formula | C8H13N5O5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 5-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1nc(N)n(C2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H13N5O5/c9-5(17)6-11-8(10)13(12-6)7-4(16)3(15)2(1-14)18-7/h2-4,7,14-16H,1H2,(H2,9,17)(H2,10,11,12)/t2-,3-,4-,7?/m1/s1 |
| InChIKey | VKTUFNONEPJUSU-APPIBIFESA-N |
| XLogP | -3.43 |
| TPSA | 169.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |