C16H15ClN4O5 — CID 25222785
5-[2-(4-chlorophenyl)ethynyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 25222785) has the molecular formula C16H15ClN4O5 and a molecular weight of 378.77 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethynyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[2-(4-chlorophenyl)ethynyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 25222785 |
| Molecular Formula | C16H15ClN4O5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethynyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1nc(C#Cc2ccc(Cl)cc2)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C16H15ClN4O5/c17-9-4-1-8(2-5-9)3-6-11-19-15(14(18)25)20-21(11)16-13(24)12(23)10(7-22)26-16/h1-2,4-5,10,12-13,16,22-24H,7H2,(H2,18,25)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | CSLLPFVUBDNHGE-XNIJJKJLSA-N |
| XLogP | -0.96 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|