C8H9Cl3N2O4 — CID 3012552
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,4,5-trichloroimidazol-1-yl)oxolane-3,4-diol (PubChem CID 3012552) has the molecular formula C8H9Cl3N2O4 and a molecular weight of 303.53 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,4,5-trichloroimidazol-1-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,4,5-trichloroimidazol-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 3012552 |
| Molecular Formula | C8H9Cl3N2O4 |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,4,5-trichloroimidazol-1-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2c(Cl)nc(Cl)c2Cl)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H9Cl3N2O4/c9-5-6(10)13(8(11)12-5)7-4(16)3(15)2(1-14)17-7/h2-4,7,14-16H,1H2/t2-,3+,4-,7-/m1/s1 |
| InChIKey | MQAVFPKBUATAJX-PAMHENJLSA-N |
| XLogP | 0.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |