C7H14B2O4 — CID 162469030
4-methyl-2-[(4-methyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane (PubChem CID 162469030) has the molecular formula C7H14B2O4 and a molecular weight of 183.81 g/mol. Its IUPAC name is 4-methyl-2-[(4-methyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane.
| Compound Name | 4-methyl-2-[(4-methyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162469030 |
| Molecular Formula | C7H14B2O4 |
| Molecular Weight | 183.81 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-methyl-2-[(4-methyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
| SMILES | CC1COB(CB2OCC(C)O2)O1 |
| InChI | InChI=1S/C7H14B2O4/c1-6-3-10-8(12-6)5-9-11-4-7(2)13-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | SZIDWPXLVVRYJA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.81 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|