C8H15BO3 — CID 551048
2-butyl-6-methyl-1,3,2-dioxaborinan-4-one (PubChem CID 551048) has the molecular formula C8H15BO3 and a molecular weight of 170.02 g/mol. Its IUPAC name is 2-butyl-6-methyl-1,3,2-dioxaborinan-4-one.
| Compound Name | 2-butyl-6-methyl-1,3,2-dioxaborinan-4-one |
|---|---|
| PubChem CID | 551048 |
| Molecular Formula | C8H15BO3 |
| Molecular Weight | 170.02 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-butyl-6-methyl-1,3,2-dioxaborinan-4-one |
| SMILES | CCCCB1OC(=O)CC(C)O1 |
| InChI | InChI=1S/C8H15BO3/c1-3-4-5-9-11-7(2)6-8(10)12-9/h7H,3-6H2,1-2H3 |
| InChIKey | WGOOHZHIMJLZBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.02 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|