C18H33B3O6 — CID 587558
3,8,13-tributyl-2,4,7,9,12,14-hexaoxa-3,8,13-triboratetracyclo[8.5.0.05,15.06,11]pentadecane (PubChem CID 587558) has the molecular formula C18H33B3O6 and a molecular weight of 377.89 g/mol. Its IUPAC name is 3,8,13-tributyl-2,4,7,9,12,14-hexaoxa-3,8,13-triboratetracyclo[8.5.0.05,15.06,11]pentadecane.
| Compound Name | 3,8,13-tributyl-2,4,7,9,12,14-hexaoxa-3,8,13-triboratetracyclo[8.5.0.05,15.06,11]pentadecane |
|---|---|
| PubChem CID | 587558 |
| Molecular Formula | C18H33B3O6 |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 3,8,13-tributyl-2,4,7,9,12,14-hexaoxa-3,8,13-triboratetracyclo[8.5.0.05,15.06,11]pentadecane |
| SMILES | CCCCB1OC2C3OB(CCCC)OC4C2OB(CCCC)OC4C3O1 |
| InChI | InChI=1S/C18H33B3O6/c1-4-7-10-19-22-13-15-18-16(25-20(24-15)11-8-5-2)14(23-19)17(13)26-21(27-18)12-9-6-3/h13-18H,4-12H2,1-3H3 |
| InChIKey | SFCOKQYXCCWXPE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|